C19H31ClN4O3S — CID 56519934
1-[2-chloro-5-(diethylsulfamoyl)phenyl]-3-[2-(1-methylpiperidin-4-yl)ethyl]urea (PubChem CID 56519934) has the molecular formula C19H31ClN4O3S and a molecular weight of 431.00 g/mol. Its IUPAC name is 1-[2-chloro-5-(diethylsulfamoyl)phenyl]-3-[2-(1-methylpiperidin-4-yl)ethyl]urea.
| Compound Name | 1-[2-chloro-5-(diethylsulfamoyl)phenyl]-3-[2-(1-methylpiperidin-4-yl)ethyl]urea |
|---|---|
| PubChem CID | 56519934 |
| Molecular Formula | C19H31ClN4O3S |
| Molecular Weight | 431.00 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | 1-[2-chloro-5-(diethylsulfamoyl)phenyl]-3-[2-(1-methylpiperidin-4-yl)ethyl]urea |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(Cl)c(NC(=O)NCCC2CCN(C)CC2)c1 |
| InChI | InChI=1S/C19H31ClN4O3S/c1-4-24(5-2)28(26,27)16-6-7-17(20)18(14-16)22-19(25)21-11-8-15-9-12-23(3)13-10-15/h6-7,14-15H,4-5,8-13H2,1-3H3,(H2,21,22,25) |
| InChIKey | SNWIUQFXHNJKHU-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.00 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |