C21H29ClN4O3S — CID 55701839
1-[2-chloro-5-(diethylsulfamoyl)phenyl]-3-[2-(N-methylanilino)propyl]urea (PubChem CID 55701839) has the molecular formula C21H29ClN4O3S and a molecular weight of 453.01 g/mol. Its IUPAC name is 1-[2-chloro-5-(diethylsulfamoyl)phenyl]-3-[2-(N-methylanilino)propyl]urea.
| Compound Name | 1-[2-chloro-5-(diethylsulfamoyl)phenyl]-3-[2-(N-methylanilino)propyl]urea |
|---|---|
| PubChem CID | 55701839 |
| Molecular Formula | C21H29ClN4O3S |
| Molecular Weight | 453.01 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | 1-[2-chloro-5-(diethylsulfamoyl)phenyl]-3-[2-(N-methylanilino)propyl]urea |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(Cl)c(NC(=O)NCC(C)N(C)c2ccccc2)c1 |
| InChI | InChI=1S/C21H29ClN4O3S/c1-5-26(6-2)30(28,29)18-12-13-19(22)20(14-18)24-21(27)23-15-16(3)25(4)17-10-8-7-9-11-17/h7-14,16H,5-6,15H2,1-4H3,(H2,23,24,27) |
| InChIKey | GTPKQJVMGHXEQD-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.01 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |