C20H33ClN4O3S — CID 112840558
N-[2-chloro-5-(diethylsulfamoyl)phenyl]-2-[4-(dimethylamino)piperidin-1-yl]propanamide (PubChem CID 112840558) has the molecular formula C20H33ClN4O3S and a molecular weight of 445.03 g/mol. Its IUPAC name is N-[2-chloro-5-(diethylsulfamoyl)phenyl]-2-[4-(dimethylamino)piperidin-1-yl]propanamide.
| Compound Name | N-[2-chloro-5-(diethylsulfamoyl)phenyl]-2-[4-(dimethylamino)piperidin-1-yl]propanamide |
|---|---|
| PubChem CID | 112840558 |
| Molecular Formula | C20H33ClN4O3S |
| Molecular Weight | 445.03 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | N-[2-chloro-5-(diethylsulfamoyl)phenyl]-2-[4-(dimethylamino)piperidin-1-yl]propanamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(Cl)c(NC(=O)C(C)N2CCC(N(C)C)CC2)c1 |
| InChI | InChI=1S/C20H33ClN4O3S/c1-6-25(7-2)29(27,28)17-8-9-18(21)19(14-17)22-20(26)15(3)24-12-10-16(11-13-24)23(4)5/h8-9,14-16H,6-7,10-13H2,1-5H3,(H,22,26) |
| InChIKey | ISLOCMRMFGLSFP-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.03 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |