C22H25ClN4O3S — CID 60552354
2-chloro-5-(diethylsulfamoyl)-N-[[3-(pyrazol-1-ylmethyl)phenyl]methyl]benzamide (PubChem CID 60552354) has the molecular formula C22H25ClN4O3S and a molecular weight of 460.99 g/mol. Its IUPAC name is 2-chloro-5-(diethylsulfamoyl)-N-[[3-(pyrazol-1-ylmethyl)phenyl]methyl]benzamide.
| Compound Name | 2-chloro-5-(diethylsulfamoyl)-N-[[3-(pyrazol-1-ylmethyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 60552354 |
| Molecular Formula | C22H25ClN4O3S |
| Molecular Weight | 460.99 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | 2-chloro-5-(diethylsulfamoyl)-N-[[3-(pyrazol-1-ylmethyl)phenyl]methyl]benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(Cl)c(C(=O)NCc2cccc(Cn3cccn3)c2)c1 |
| InChI | InChI=1S/C22H25ClN4O3S/c1-3-27(4-2)31(29,30)19-9-10-21(23)20(14-19)22(28)24-15-17-7-5-8-18(13-17)16-26-12-6-11-25-26/h5-14H,3-4,15-16H2,1-2H3,(H,24,28) |
| InChIKey | FMTZYYRGEPWMPN-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.99 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |