C16H20ClN3O — CID 19325839
N-[3-(4-chloro-3-methylpyrazol-1-yl)propyl]-2,4-dimethylbenzamide (PubChem CID 19325839) has the molecular formula C16H20ClN3O and a molecular weight of 305.81 g/mol. Its IUPAC name is N-[3-(4-chloro-3-methylpyrazol-1-yl)propyl]-2,4-dimethylbenzamide.
| Compound Name | N-[3-(4-chloro-3-methylpyrazol-1-yl)propyl]-2,4-dimethylbenzamide |
|---|---|
| PubChem CID | 19325839 |
| Molecular Formula | C16H20ClN3O |
| Molecular Weight | 305.81 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | N-[3-(4-chloro-3-methylpyrazol-1-yl)propyl]-2,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)NCCCn2cc(Cl)c(C)n2)c(C)c1 |
| InChI | InChI=1S/C16H20ClN3O/c1-11-5-6-14(12(2)9-11)16(21)18-7-4-8-20-10-15(17)13(3)19-20/h5-6,9-10H,4,7-8H2,1-3H3,(H,18,21) |
| InChIKey | ITWRJOKPHSUGKW-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.81 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|