C13H24ClN5S — CID 4776183
1-[3-(4-chloro-3-methylpyrazol-1-yl)propyl]-3-[3-(dimethylamino)propyl]thiourea (PubChem CID 4776183) has the molecular formula C13H24ClN5S and a molecular weight of 317.89 g/mol. Its IUPAC name is 1-[3-(4-chloro-3-methylpyrazol-1-yl)propyl]-3-[3-(dimethylamino)propyl]thiourea.
| Compound Name | 1-[3-(4-chloro-3-methylpyrazol-1-yl)propyl]-3-[3-(dimethylamino)propyl]thiourea |
|---|---|
| PubChem CID | 4776183 |
| Molecular Formula | C13H24ClN5S |
| Molecular Weight | 317.89 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 1-[3-(4-chloro-3-methylpyrazol-1-yl)propyl]-3-[3-(dimethylamino)propyl]thiourea |
| SMILES | Cc1nn(CCCNC(=S)NCCCN(C)C)cc1Cl |
| InChI | InChI=1S/C13H24ClN5S/c1-11-12(14)10-19(17-11)9-5-7-16-13(20)15-6-4-8-18(2)3/h10H,4-9H2,1-3H3,(H2,15,16,20) |
| InChIKey | WDLBXHDPRBYDMM-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 45.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.89 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|