C12H23N5S — CID 19324881
1-[3-(dimethylamino)propyl]-3-[(1,3-dimethylpyrazol-4-yl)methyl]thiourea (PubChem CID 19324881) has the molecular formula C12H23N5S and a molecular weight of 269.42 g/mol. Its IUPAC name is 1-[3-(dimethylamino)propyl]-3-[(1,3-dimethylpyrazol-4-yl)methyl]thiourea.
| Compound Name | 1-[3-(dimethylamino)propyl]-3-[(1,3-dimethylpyrazol-4-yl)methyl]thiourea |
|---|---|
| PubChem CID | 19324881 |
| Molecular Formula | C12H23N5S |
| Molecular Weight | 269.42 g/mol |
| Exact Mass | 269.17 |
| IUPAC Name | 1-[3-(dimethylamino)propyl]-3-[(1,3-dimethylpyrazol-4-yl)methyl]thiourea |
| SMILES | Cc1nn(C)cc1CNC(=S)NCCCN(C)C |
| InChI | InChI=1S/C12H23N5S/c1-10-11(9-17(4)15-10)8-14-12(18)13-6-5-7-16(2)3/h9H,5-8H2,1-4H3,(H2,13,14,18) |
| InChIKey | FVKYHXHLWQRWLL-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 45.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.42 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|