C10H19N5S — CID 19401597
1-[3-(dimethylamino)propyl]-3-(1-methylpyrazol-3-yl)thiourea (PubChem CID 19401597) has the molecular formula C10H19N5S and a molecular weight of 241.36 g/mol. Its IUPAC name is 1-[3-(dimethylamino)propyl]-3-(1-methylpyrazol-3-yl)thiourea.
| Compound Name | 1-[3-(dimethylamino)propyl]-3-(1-methylpyrazol-3-yl)thiourea |
|---|---|
| PubChem CID | 19401597 |
| Molecular Formula | C10H19N5S |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | 1-[3-(dimethylamino)propyl]-3-(1-methylpyrazol-3-yl)thiourea |
| SMILES | CN(C)CCCNC(=S)Nc1ccn(C)n1 |
| InChI | InChI=1S/C10H19N5S/c1-14(2)7-4-6-11-10(16)12-9-5-8-15(3)13-9/h5,8H,4,6-7H2,1-3H3,(H2,11,12,13,16) |
| InChIKey | LJTDFUNPJDAJLF-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 45.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|