C12H22ClN5S — CID 19327050
1-[(4-chloro-1-ethylpyrazol-5-yl)methyl]-3-[3-(dimethylamino)propyl]thiourea (PubChem CID 19327050) has the molecular formula C12H22ClN5S and a molecular weight of 303.86 g/mol. Its IUPAC name is 1-[(4-chloro-1-ethylpyrazol-5-yl)methyl]-3-[3-(dimethylamino)propyl]thiourea.
| Compound Name | 1-[(4-chloro-1-ethylpyrazol-5-yl)methyl]-3-[3-(dimethylamino)propyl]thiourea |
|---|---|
| PubChem CID | 19327050 |
| Molecular Formula | C12H22ClN5S |
| Molecular Weight | 303.86 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 1-[(4-chloro-1-ethylpyrazol-5-yl)methyl]-3-[3-(dimethylamino)propyl]thiourea |
| SMILES | CCn1ncc(Cl)c1CNC(=S)NCCCN(C)C |
| InChI | InChI=1S/C12H22ClN5S/c1-4-18-11(10(13)8-16-18)9-15-12(19)14-6-5-7-17(2)3/h8H,4-7,9H2,1-3H3,(H2,14,15,19) |
| InChIKey | MIJFNAVFPMVSDF-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 45.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.86 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|