C11H21ClN4O — CID 114652225
N-[[4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]methyl]-2-methoxyethanamine (PubChem CID 114652225) has the molecular formula C11H21ClN4O and a molecular weight of 260.77 g/mol. Its IUPAC name is N-[[4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 114652225 |
| Molecular Formula | C11H21ClN4O |
| Molecular Weight | 260.77 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | N-[[4-chloro-1-[2-(dimethylamino)ethyl]pyrazol-5-yl]methyl]-2-methoxyethanamine |
| SMILES | COCCNCc1c(Cl)cnn1CCN(C)C |
| InChI | InChI=1S/C11H21ClN4O/c1-15(2)5-6-16-11(10(12)8-14-16)9-13-4-7-17-3/h8,13H,4-7,9H2,1-3H3 |
| InChIKey | HMPJPWRTAIDHTM-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.77 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|