C18H22F5N5S — CID 19396978
1-[3-(diethylamino)propyl]-3-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-3-yl]thiourea (PubChem CID 19396978) has the molecular formula C18H22F5N5S and a molecular weight of 435.47 g/mol. Its IUPAC name is 1-[3-(diethylamino)propyl]-3-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-3-yl]thiourea.
| Compound Name | 1-[3-(diethylamino)propyl]-3-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-3-yl]thiourea |
|---|---|
| PubChem CID | 19396978 |
| Molecular Formula | C18H22F5N5S |
| Molecular Weight | 435.47 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | 1-[3-(diethylamino)propyl]-3-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-3-yl]thiourea |
| SMILES | CCN(CC)CCCNC(=S)Nc1ccn(Cc2c(F)c(F)c(F)c(F)c2F)n1 |
| InChI | InChI=1S/C18H22F5N5S/c1-3-27(4-2)8-5-7-24-18(29)25-12-6-9-28(26-12)10-11-13(19)15(21)17(23)16(22)14(11)20/h6,9H,3-5,7-8,10H2,1-2H3,(H2,24,25,26,29) |
| InChIKey | BWEVWIXVWWSCLZ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 45.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.47 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|