C19H15F5N4S — CID 19396989
1-(2,3-dimethylphenyl)-3-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-3-yl]thiourea (PubChem CID 19396989) has the molecular formula C19H15F5N4S and a molecular weight of 426.41 g/mol. Its IUPAC name is 1-(2,3-dimethylphenyl)-3-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-3-yl]thiourea.
| Compound Name | 1-(2,3-dimethylphenyl)-3-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-3-yl]thiourea |
|---|---|
| PubChem CID | 19396989 |
| Molecular Formula | C19H15F5N4S |
| Molecular Weight | 426.41 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | 1-(2,3-dimethylphenyl)-3-[1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-3-yl]thiourea |
| SMILES | Cc1cccc(NC(=S)Nc2ccn(Cc3c(F)c(F)c(F)c(F)c3F)n2)c1C |
| InChI | InChI=1S/C19H15F5N4S/c1-9-4-3-5-12(10(9)2)25-19(29)26-13-6-7-28(27-13)8-11-14(20)16(22)18(24)17(23)15(11)21/h3-7H,8H2,1-2H3,(H2,25,26,27,29) |
| InChIKey | FQMBWLPXDMPWTA-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.41 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|