C16H28FN3 — CID 84753829
N-[[3-(dimethylamino)-4-fluorophenyl]methyl]-N',N'-diethylpropane-1,3-diamine (PubChem CID 84753829) has the molecular formula C16H28FN3 and a molecular weight of 281.42 g/mol. Its IUPAC name is N-[[3-(dimethylamino)-4-fluorophenyl]methyl]-N',N'-diethylpropane-1,3-diamine.
| Compound Name | N-[[3-(dimethylamino)-4-fluorophenyl]methyl]-N',N'-diethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 84753829 |
| Molecular Formula | C16H28FN3 |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.23 |
| IUPAC Name | N-[[3-(dimethylamino)-4-fluorophenyl]methyl]-N',N'-diethylpropane-1,3-diamine |
| SMILES | CCN(CC)CCCNCc1ccc(F)c(N(C)C)c1 |
| InChI | InChI=1S/C16H28FN3/c1-5-20(6-2)11-7-10-18-13-14-8-9-15(17)16(12-14)19(3)4/h8-9,12,18H,5-7,10-11,13H2,1-4H3 |
| InChIKey | LSIPUOAVSMFJQU-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|