C14H23FN2O2 — CID 84753642
3-[[3-[ethyl(2-hydroxyethyl)amino]-4-fluorophenyl]methylamino]propan-1-ol (PubChem CID 84753642) has the molecular formula C14H23FN2O2 and a molecular weight of 270.35 g/mol. Its IUPAC name is 3-[[3-[ethyl(2-hydroxyethyl)amino]-4-fluorophenyl]methylamino]propan-1-ol.
| Compound Name | 3-[[3-[ethyl(2-hydroxyethyl)amino]-4-fluorophenyl]methylamino]propan-1-ol |
|---|---|
| PubChem CID | 84753642 |
| Molecular Formula | C14H23FN2O2 |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | 3-[[3-[ethyl(2-hydroxyethyl)amino]-4-fluorophenyl]methylamino]propan-1-ol |
| SMILES | CCN(CCO)c1cc(CNCCCO)ccc1F |
| InChI | InChI=1S/C14H23FN2O2/c1-2-17(7-9-19)14-10-12(4-5-13(14)15)11-16-6-3-8-18/h4-5,10,16,18-19H,2-3,6-9,11H2,1H3 |
| InChIKey | HIVVUNJPUVUGPP-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|