C16H25FN2 — CID 84753418
N-butyl-N-ethyl-2-fluoro-5-[(prop-2-enylamino)methyl]aniline (PubChem CID 84753418) has the molecular formula C16H25FN2 and a molecular weight of 264.39 g/mol. Its IUPAC name is N-butyl-N-ethyl-2-fluoro-5-[(prop-2-enylamino)methyl]aniline.
| Compound Name | N-butyl-N-ethyl-2-fluoro-5-[(prop-2-enylamino)methyl]aniline |
|---|---|
| PubChem CID | 84753418 |
| Molecular Formula | C16H25FN2 |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.20 |
| IUPAC Name | N-butyl-N-ethyl-2-fluoro-5-[(prop-2-enylamino)methyl]aniline |
| SMILES | C=CCNCc1ccc(F)c(N(CC)CCCC)c1 |
| InChI | InChI=1S/C16H25FN2/c1-4-7-11-19(6-3)16-12-14(8-9-15(16)17)13-18-10-5-2/h5,8-9,12,18H,2,4,6-7,10-11,13H2,1,3H3 |
| InChIKey | SEHVZHUREKWALS-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|