C19H25FN2O — CID 84753512
3-[[3-[benzyl(ethyl)amino]-4-fluorophenyl]methylamino]propan-1-ol (PubChem CID 84753512) has the molecular formula C19H25FN2O and a molecular weight of 316.42 g/mol. Its IUPAC name is 3-[[3-[benzyl(ethyl)amino]-4-fluorophenyl]methylamino]propan-1-ol.
| Compound Name | 3-[[3-[benzyl(ethyl)amino]-4-fluorophenyl]methylamino]propan-1-ol |
|---|---|
| PubChem CID | 84753512 |
| Molecular Formula | C19H25FN2O |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | 3-[[3-[benzyl(ethyl)amino]-4-fluorophenyl]methylamino]propan-1-ol |
| SMILES | CCN(Cc1ccccc1)c1cc(CNCCCO)ccc1F |
| InChI | InChI=1S/C19H25FN2O/c1-2-22(15-16-7-4-3-5-8-16)19-13-17(9-10-18(19)20)14-21-11-6-12-23/h3-5,7-10,13,21,23H,2,6,11-12,14-15H2,1H3 |
| InChIKey | PMOIEDZNESIRNS-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|