C14H23FN2O — CID 84747186
5-[(3-ethoxypropylamino)methyl]-2-fluoro-N,N-dimethylaniline (PubChem CID 84747186) has the molecular formula C14H23FN2O and a molecular weight of 254.35 g/mol. Its IUPAC name is 5-[(3-ethoxypropylamino)methyl]-2-fluoro-N,N-dimethylaniline.
| Compound Name | 5-[(3-ethoxypropylamino)methyl]-2-fluoro-N,N-dimethylaniline |
|---|---|
| PubChem CID | 84747186 |
| Molecular Formula | C14H23FN2O |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | 5-[(3-ethoxypropylamino)methyl]-2-fluoro-N,N-dimethylaniline |
| SMILES | CCOCCCNCc1ccc(F)c(N(C)C)c1 |
| InChI | InChI=1S/C14H23FN2O/c1-4-18-9-5-8-16-11-12-6-7-13(15)14(10-12)17(2)3/h6-7,10,16H,4-5,8-9,11H2,1-3H3 |
| InChIKey | RCDLPZYCRGGMJR-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|