C17H27FN2O2 — CID 84753981
ethyl 3-[5-(butylaminomethyl)-2-fluoro-N-methylanilino]propanoate (PubChem CID 84753981) has the molecular formula C17H27FN2O2 and a molecular weight of 310.41 g/mol. Its IUPAC name is ethyl 3-[5-(butylaminomethyl)-2-fluoro-N-methylanilino]propanoate.
| Compound Name | ethyl 3-[5-(butylaminomethyl)-2-fluoro-N-methylanilino]propanoate |
|---|---|
| PubChem CID | 84753981 |
| Molecular Formula | C17H27FN2O2 |
| Molecular Weight | 310.41 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | ethyl 3-[5-(butylaminomethyl)-2-fluoro-N-methylanilino]propanoate |
| SMILES | CCCCNCc1ccc(F)c(N(C)CCC(=O)OCC)c1 |
| InChI | InChI=1S/C17H27FN2O2/c1-4-6-10-19-13-14-7-8-15(18)16(12-14)20(3)11-9-17(21)22-5-2/h7-8,12,19H,4-6,9-11,13H2,1-3H3 |
| InChIKey | MHADACNRQDNTOJ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.41 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|