C14H19F2NO2 — CID 82532984
3-[(3,4-difluorophenyl)methylamino]propyl butanoate (PubChem CID 82532984) has the molecular formula C14H19F2NO2 and a molecular weight of 271.31 g/mol. Its IUPAC name is 3-[(3,4-difluorophenyl)methylamino]propyl butanoate.
| Compound Name | 3-[(3,4-difluorophenyl)methylamino]propyl butanoate |
|---|---|
| PubChem CID | 82532984 |
| Molecular Formula | C14H19F2NO2 |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 3-[(3,4-difluorophenyl)methylamino]propyl butanoate |
| SMILES | CCCC(=O)OCCCNCc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H19F2NO2/c1-2-4-14(18)19-8-3-7-17-10-11-5-6-12(15)13(16)9-11/h5-6,9,17H,2-4,7-8,10H2,1H3 |
| InChIKey | CCICUMWDRJUELC-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|