C12H19N3 — CID 144690137
N'-[(4-ethenyl-2-pyridinyl)methyl]-N-methylpropane-1,3-diamine (PubChem CID 144690137) has the molecular formula C12H19N3 and a molecular weight of 205.31 g/mol. Its IUPAC name is N'-[(4-ethenyl-2-pyridinyl)methyl]-N-methylpropane-1,3-diamine.
| Compound Name | N'-[(4-ethenyl-2-pyridinyl)methyl]-N-methylpropane-1,3-diamine |
|---|---|
| PubChem CID | 144690137 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.31 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | N'-[(4-ethenyl-2-pyridinyl)methyl]-N-methylpropane-1,3-diamine |
| SMILES | C=Cc1ccnc(CNCCCNC)c1 |
| InChI | InChI=1S/C12H19N3/c1-3-11-5-8-15-12(9-11)10-14-7-4-6-13-2/h3,5,8-9,13-14H,1,4,6-7,10H2,2H3 |
| InChIKey | FRBDCBDZUXADGW-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.31 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|