C26H36N4O3 — CID 70286937
7-[[4-(diethylamino)butylamino]methyl]-3-(3,5-dimethoxy-2-methylphenyl)-1H-1,6-naphthyridin-2-one (PubChem CID 70286937) has the molecular formula C26H36N4O3 and a molecular weight of 452.60 g/mol. Its IUPAC name is 7-[[4-(diethylamino)butylamino]methyl]-3-(3,5-dimethoxy-2-methylphenyl)-1H-1,6-naphthyridin-2-one.
| Compound Name | 7-[[4-(diethylamino)butylamino]methyl]-3-(3,5-dimethoxy-2-methylphenyl)-1H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 70286937 |
| Molecular Formula | C26H36N4O3 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.28 |
| IUPAC Name | 7-[[4-(diethylamino)butylamino]methyl]-3-(3,5-dimethoxy-2-methylphenyl)-1H-1,6-naphthyridin-2-one |
| SMILES | CCN(CC)CCCCNCc1cc2[nH]c(=O)c(-c3cc(OC)cc(OC)c3C)cc2cn1 |
| InChI | InChI=1S/C26H36N4O3/c1-6-30(7-2)11-9-8-10-27-17-20-13-24-19(16-28-20)12-23(26(31)29-24)22-14-21(32-4)15-25(33-5)18(22)3/h12-16,27H,6-11,17H2,1-5H3,(H,29,31) |
| InChIKey | IMDUCOQORRVCRU-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 79.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|