C26H37IN4O4 — CID 126755576
[4-[2-iodoethoxycarbonyl(methyl)amino]phenyl]methyl 2-[[4-(diethylamino)butylamino]methyl]pyridine-4-carboxylate (PubChem CID 126755576) has the molecular formula C26H37IN4O4 and a molecular weight of 596.51 g/mol. Its IUPAC name is [4-[2-iodoethoxycarbonyl(methyl)amino]phenyl]methyl 2-[[4-(diethylamino)butylamino]methyl]pyridine-4-carboxylate.
| Compound Name | [4-[2-iodoethoxycarbonyl(methyl)amino]phenyl]methyl 2-[[4-(diethylamino)butylamino]methyl]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 126755576 |
| Molecular Formula | C26H37IN4O4 |
| Molecular Weight | 596.51 g/mol |
| Exact Mass | 596.19 |
| IUPAC Name | [4-[2-iodoethoxycarbonyl(methyl)amino]phenyl]methyl 2-[[4-(diethylamino)butylamino]methyl]pyridine-4-carboxylate |
| SMILES | CCN(CC)CCCCNCc1cc(C(=O)OCc2ccc(N(C)C(=O)OCCI)cc2)ccn1 |
| InChI | InChI=1S/C26H37IN4O4/c1-4-31(5-2)16-7-6-14-28-19-23-18-22(12-15-29-23)25(32)35-20-21-8-10-24(11-9-21)30(3)26(33)34-17-13-27/h8-12,15,18,28H,4-7,13-14,16-17,19-20H2,1-3H3 |
| InChIKey | NHXKTYOWNUBFFH-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.51 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|