C27H39N3O4 — CID 149228630
[4-[ethoxycarbonyl(methyl)amino]phenyl]methyl 2-[6-(diethylamino)hexyl]pyridine-4-carboxylate (PubChem CID 149228630) has the molecular formula C27H39N3O4 and a molecular weight of 469.63 g/mol. Its IUPAC name is [4-[ethoxycarbonyl(methyl)amino]phenyl]methyl 2-[6-(diethylamino)hexyl]pyridine-4-carboxylate.
| Compound Name | [4-[ethoxycarbonyl(methyl)amino]phenyl]methyl 2-[6-(diethylamino)hexyl]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 149228630 |
| Molecular Formula | C27H39N3O4 |
| Molecular Weight | 469.63 g/mol |
| Exact Mass | 469.29 |
| IUPAC Name | [4-[ethoxycarbonyl(methyl)amino]phenyl]methyl 2-[6-(diethylamino)hexyl]pyridine-4-carboxylate |
| SMILES | CCOC(=O)N(C)c1ccc(COC(=O)c2ccnc(CCCCCCN(CC)CC)c2)cc1 |
| InChI | InChI=1S/C27H39N3O4/c1-5-30(6-2)19-11-9-8-10-12-24-20-23(17-18-28-24)26(31)34-21-22-13-15-25(16-14-22)29(4)27(32)33-7-3/h13-18,20H,5-12,19,21H2,1-4H3 |
| InChIKey | XJWCOLHAOORBBR-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 71.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.63 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|