C15H20Cl2N2O2 — CID 123206996
2,6-dichloro-4-[(3-morpholin-4-ylpropylamino)methyl]benzaldehyde (PubChem CID 123206996) has the molecular formula C15H20Cl2N2O2 and a molecular weight of 331.24 g/mol. Its IUPAC name is 2,6-dichloro-4-[(3-morpholin-4-ylpropylamino)methyl]benzaldehyde.
| Compound Name | 2,6-dichloro-4-[(3-morpholin-4-ylpropylamino)methyl]benzaldehyde |
|---|---|
| PubChem CID | 123206996 |
| Molecular Formula | C15H20Cl2N2O2 |
| Molecular Weight | 331.24 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 2,6-dichloro-4-[(3-morpholin-4-ylpropylamino)methyl]benzaldehyde |
| SMILES | O=Cc1c(Cl)cc(CNCCCN2CCOCC2)cc1Cl |
| InChI | InChI=1S/C15H20Cl2N2O2/c16-14-8-12(9-15(17)13(14)11-20)10-18-2-1-3-19-4-6-21-7-5-19/h8-9,11,18H,1-7,10H2 |
| InChIKey | LVTORBIHTJEHOQ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.24 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|