C19H18Cl2F2N2O2S — CID 3336148
N-[(2,4-dichlorophenyl)methyl]-2-[(2,5-difluorophenoxy)methyl]morpholine-4-carbothioamide (PubChem CID 3336148) has the molecular formula C19H18Cl2F2N2O2S and a molecular weight of 447.33 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)methyl]-2-[(2,5-difluorophenoxy)methyl]morpholine-4-carbothioamide.
| Compound Name | N-[(2,4-dichlorophenyl)methyl]-2-[(2,5-difluorophenoxy)methyl]morpholine-4-carbothioamide |
|---|---|
| PubChem CID | 3336148 |
| Molecular Formula | C19H18Cl2F2N2O2S |
| Molecular Weight | 447.33 g/mol |
| Exact Mass | 446.04 |
| IUPAC Name | N-[(2,4-dichlorophenyl)methyl]-2-[(2,5-difluorophenoxy)methyl]morpholine-4-carbothioamide |
| SMILES | Fc1ccc(F)c(OCC2CN(C(=S)NCc3ccc(Cl)cc3Cl)CCO2)c1 |
| InChI | InChI=1S/C19H18Cl2F2N2O2S/c20-13-2-1-12(16(21)7-13)9-24-19(28)25-5-6-26-15(10-25)11-27-18-8-14(22)3-4-17(18)23/h1-4,7-8,15H,5-6,9-11H2,(H,24,28) |
| InChIKey | YRYSMDVISQPHDQ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.33 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|