C20H24BrFN4O2S — CID 3575065
N-(2-bromo-4-fluorophenyl)-2-[(6-methyl-2-propan-2-ylpyrimidin-4-yl)oxymethyl]morpholine-4-carbothioamide (PubChem CID 3575065) has the molecular formula C20H24BrFN4O2S and a molecular weight of 483.41 g/mol. Its IUPAC name is N-(2-bromo-4-fluorophenyl)-2-[(6-methyl-2-propan-2-ylpyrimidin-4-yl)oxymethyl]morpholine-4-carbothioamide.
| Compound Name | N-(2-bromo-4-fluorophenyl)-2-[(6-methyl-2-propan-2-ylpyrimidin-4-yl)oxymethyl]morpholine-4-carbothioamide |
|---|---|
| PubChem CID | 3575065 |
| Molecular Formula | C20H24BrFN4O2S |
| Molecular Weight | 483.41 g/mol |
| Exact Mass | 482.08 |
| IUPAC Name | N-(2-bromo-4-fluorophenyl)-2-[(6-methyl-2-propan-2-ylpyrimidin-4-yl)oxymethyl]morpholine-4-carbothioamide |
| SMILES | Cc1cc(OCC2CN(C(=S)Nc3ccc(F)cc3Br)CCO2)nc(C(C)C)n1 |
| InChI | InChI=1S/C20H24BrFN4O2S/c1-12(2)19-23-13(3)8-18(25-19)28-11-15-10-26(6-7-27-15)20(29)24-17-5-4-14(22)9-16(17)21/h4-5,8-9,12,15H,6-7,10-11H2,1-3H3,(H,24,29) |
| InChIKey | COIPQZFRESGZLC-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.41 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|