C23H26N4O5 — CID 4984191
2-[2-[2-[(6-methyl-2-propan-2-ylpyrimidin-4-yl)oxymethyl]morpholin-4-yl]-2-oxoethyl]isoindole-1,3-dione (PubChem CID 4984191) has the molecular formula C23H26N4O5 and a molecular weight of 438.48 g/mol. Its IUPAC name is 2-[2-[2-[(6-methyl-2-propan-2-ylpyrimidin-4-yl)oxymethyl]morpholin-4-yl]-2-oxoethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[2-[(6-methyl-2-propan-2-ylpyrimidin-4-yl)oxymethyl]morpholin-4-yl]-2-oxoethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 4984191 |
| Molecular Formula | C23H26N4O5 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | 2-[2-[2-[(6-methyl-2-propan-2-ylpyrimidin-4-yl)oxymethyl]morpholin-4-yl]-2-oxoethyl]isoindole-1,3-dione |
| SMILES | Cc1cc(OCC2CN(C(=O)CN3C(=O)c4ccccc4C3=O)CCO2)nc(C(C)C)n1 |
| InChI | InChI=1S/C23H26N4O5/c1-14(2)21-24-15(3)10-19(25-21)32-13-16-11-26(8-9-31-16)20(28)12-27-22(29)17-6-4-5-7-18(17)23(27)30/h4-7,10,14,16H,8-9,11-13H2,1-3H3 |
| InChIKey | OENLKSMHWDRIQH-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 101.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|