C21H17F5N2O5 — CID 3736387
methyl 5-[[4-[3-(2,3,4,5,6-pentafluorophenyl)prop-2-enoyl]morpholin-2-yl]methoxy]pyridine-3-carboxylate (PubChem CID 3736387) has the molecular formula C21H17F5N2O5 and a molecular weight of 472.37 g/mol. Its IUPAC name is methyl 5-[[4-[3-(2,3,4,5,6-pentafluorophenyl)prop-2-enoyl]morpholin-2-yl]methoxy]pyridine-3-carboxylate.
| Compound Name | methyl 5-[[4-[3-(2,3,4,5,6-pentafluorophenyl)prop-2-enoyl]morpholin-2-yl]methoxy]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 3736387 |
| Molecular Formula | C21H17F5N2O5 |
| Molecular Weight | 472.37 g/mol |
| Exact Mass | 472.11 |
| IUPAC Name | methyl 5-[[4-[3-(2,3,4,5,6-pentafluorophenyl)prop-2-enoyl]morpholin-2-yl]methoxy]pyridine-3-carboxylate |
| SMILES | COC(=O)c1cncc(OCC2CN(C(=O)C=Cc3c(F)c(F)c(F)c(F)c3F)CCO2)c1 |
| InChI | InChI=1S/C21H17F5N2O5/c1-31-21(30)11-6-12(8-27-7-11)33-10-13-9-28(4-5-32-13)15(29)3-2-14-16(22)18(24)20(26)19(25)17(14)23/h2-3,6-8,13H,4-5,9-10H2,1H3 |
| InChIKey | KMRZZOFOZTVJDC-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 77.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.37 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|