C36H51ClN2O12 — CID 159840394
tert-butyl 2-(chloromethyl)morpholine-4-carboxylate;tert-butyl 2-[(4-methoxycarbonylphenoxy)methyl]morpholine-4-carboxylate;methyl 4-hydroxybenzoate (PubChem CID 159840394) has the molecular formula C36H51ClN2O12 and a molecular weight of 739.26 g/mol. Its IUPAC name is tert-butyl 2-(chloromethyl)morpholine-4-carboxylate;tert-butyl 2-[(4-methoxycarbonylphenoxy)methyl]morpholine-4-carboxylate;methyl 4-hydroxybenzoate.
| Compound Name | tert-butyl 2-(chloromethyl)morpholine-4-carboxylate;tert-butyl 2-[(4-methoxycarbonylphenoxy)methyl]morpholine-4-carboxylate;methyl 4-hydroxybenzoate |
|---|---|
| PubChem CID | 159840394 |
| Molecular Formula | C36H51ClN2O12 |
| Molecular Weight | 739.26 g/mol |
| Exact Mass | 738.31 |
| IUPAC Name | tert-butyl 2-(chloromethyl)morpholine-4-carboxylate;tert-butyl 2-[(4-methoxycarbonylphenoxy)methyl]morpholine-4-carboxylate;methyl 4-hydroxybenzoate |
| SMILES | CC(C)(C)OC(=O)N1CCOC(CCl)C1.COC(=O)c1ccc(O)cc1.COC(=O)c1ccc(OCC2CN(C(=O)OC(C)(C)C)CCO2)cc1 |
| InChI | InChI=1S/C18H25NO6.C10H18ClNO3.C8H8O3/c1-18(2,3)25-17(21)19-9-10-23-15(11-19)12-24-14-7-5-13(6-8-14)16(20)22-4;1-10(2,3)15-9(13)12-4-5-14-8(6-11)7-12;1-11-8(10)6-2-4-7(9)5-3-6/h5-8,15H,9-12H2,1-4H3;8H,4-7H2,1-3H3;2-5,9H,1H3 |
| InChIKey | NOPICLUJEJDIEJ-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 159.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.26 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|