C13H22N4O3 — CID 118023184
tert-butyl 2-[(4-aminopyrazol-1-yl)methyl]morpholine-4-carboxylate (PubChem CID 118023184) has the molecular formula C13H22N4O3 and a molecular weight of 282.34 g/mol. Its IUPAC name is tert-butyl 2-[(4-aminopyrazol-1-yl)methyl]morpholine-4-carboxylate.
| Compound Name | tert-butyl 2-[(4-aminopyrazol-1-yl)methyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 118023184 |
| Molecular Formula | C13H22N4O3 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | tert-butyl 2-[(4-aminopyrazol-1-yl)methyl]morpholine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCOC(Cn2cc(N)cn2)C1 |
| InChI | InChI=1S/C13H22N4O3/c1-13(2,3)20-12(18)16-4-5-19-11(8-16)9-17-7-10(14)6-15-17/h6-7,11H,4-5,8-9,14H2,1-3H3 |
| InChIKey | WNTSVFACNCAXHI-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |