C16H22Cl2N4O2 — CID 119947134
(2-aminophenyl)-[2-[(4-methylpyrazol-1-yl)methyl]morpholin-4-yl]methanone;dihydrochloride (PubChem CID 119947134) has the molecular formula C16H22Cl2N4O2 and a molecular weight of 373.28 g/mol. Its IUPAC name is (2-aminophenyl)-[2-[(4-methylpyrazol-1-yl)methyl]morpholin-4-yl]methanone;dihydrochloride.
| Compound Name | (2-aminophenyl)-[2-[(4-methylpyrazol-1-yl)methyl]morpholin-4-yl]methanone;dihydrochloride |
|---|---|
| PubChem CID | 119947134 |
| Molecular Formula | C16H22Cl2N4O2 |
| Molecular Weight | 373.28 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | (2-aminophenyl)-[2-[(4-methylpyrazol-1-yl)methyl]morpholin-4-yl]methanone;dihydrochloride |
| SMILES | Cc1cnn(CC2CN(C(=O)c3ccccc3N)CCO2)c1.Cl.Cl |
| InChI | InChI=1S/C16H20N4O2.2ClH/c1-12-8-18-20(9-12)11-13-10-19(6-7-22-13)16(21)14-4-2-3-5-15(14)17;;/h2-5,8-9,13H,6-7,10-11,17H2,1H3;2*1H |
| InChIKey | SUGNNWMDCHNMGV-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 73.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.28 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|