C15H22F2N2 — CID 82919278
N-[[1-[(3,4-difluorophenyl)methyl]pyrrolidin-2-yl]methyl]propan-1-amine (PubChem CID 82919278) has the molecular formula C15H22F2N2 and a molecular weight of 268.35 g/mol. Its IUPAC name is N-[[1-[(3,4-difluorophenyl)methyl]pyrrolidin-2-yl]methyl]propan-1-amine.
| Compound Name | N-[[1-[(3,4-difluorophenyl)methyl]pyrrolidin-2-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 82919278 |
| Molecular Formula | C15H22F2N2 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | N-[[1-[(3,4-difluorophenyl)methyl]pyrrolidin-2-yl]methyl]propan-1-amine |
| SMILES | CCCNCC1CCCN1Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C15H22F2N2/c1-2-7-18-10-13-4-3-8-19(13)11-12-5-6-14(16)15(17)9-12/h5-6,9,13,18H,2-4,7-8,10-11H2,1H3 |
| InChIKey | UMOUFQHODWGOMV-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|