C18H22N2O5S — CID 110312722
2-[2-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-ylsulfonyl)ethyl]isoindole-1,3-dione (PubChem CID 110312722) has the molecular formula C18H22N2O5S and a molecular weight of 378.45 g/mol. Its IUPAC name is 2-[2-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-ylsulfonyl)ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-ylsulfonyl)ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 110312722 |
| Molecular Formula | C18H22N2O5S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 2-[2-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-ylsulfonyl)ethyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCS(=O)(=O)N1CCOC2CCCCC21 |
| InChI | InChI=1S/C18H22N2O5S/c21-17-13-5-1-2-6-14(13)18(22)19(17)10-12-26(23,24)20-9-11-25-16-8-4-3-7-15(16)20/h1-2,5-6,15-16H,3-4,7-12H2 |
| InChIKey | CEJXSKOGLASSFQ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|