C16H23NO3S — CID 110314596
4-[(4-methylphenyl)methylsulfonyl]-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine (PubChem CID 110314596) has the molecular formula C16H23NO3S and a molecular weight of 309.43 g/mol. Its IUPAC name is 4-[(4-methylphenyl)methylsulfonyl]-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine.
| Compound Name | 4-[(4-methylphenyl)methylsulfonyl]-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine |
|---|---|
| PubChem CID | 110314596 |
| Molecular Formula | C16H23NO3S |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 4-[(4-methylphenyl)methylsulfonyl]-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine |
| SMILES | Cc1ccc(CS(=O)(=O)N2CCOC3CCCCC32)cc1 |
| InChI | InChI=1S/C16H23NO3S/c1-13-6-8-14(9-7-13)12-21(18,19)17-10-11-20-16-5-3-2-4-15(16)17/h6-9,15-16H,2-5,10-12H2,1H3 |
| InChIKey | KVBZBCZDDWQJAV-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |