C11H14ClNO3S — CID 110740261
3-[(4-chlorophenyl)methylsulfonyl]-2-methyl-1,3-oxazolidine (PubChem CID 110740261) has the molecular formula C11H14ClNO3S and a molecular weight of 275.76 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)methylsulfonyl]-2-methyl-1,3-oxazolidine.
| Compound Name | 3-[(4-chlorophenyl)methylsulfonyl]-2-methyl-1,3-oxazolidine |
|---|---|
| PubChem CID | 110740261 |
| Molecular Formula | C11H14ClNO3S |
| Molecular Weight | 275.76 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | 3-[(4-chlorophenyl)methylsulfonyl]-2-methyl-1,3-oxazolidine |
| SMILES | CC1OCCN1S(=O)(=O)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H14ClNO3S/c1-9-13(6-7-16-9)17(14,15)8-10-2-4-11(12)5-3-10/h2-5,9H,6-8H2,1H3 |
| InChIKey | WZWMCLWJTVBYHF-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.76 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |