C12H18NO5PS — CID 20718903
[1-[(4-methylphenyl)methylsulfonyl]pyrrolidin-2-yl]phosphonic acid (PubChem CID 20718903) has the molecular formula C12H18NO5PS and a molecular weight of 319.32 g/mol. Its IUPAC name is [1-[(4-methylphenyl)methylsulfonyl]pyrrolidin-2-yl]phosphonic acid.
| Compound Name | [1-[(4-methylphenyl)methylsulfonyl]pyrrolidin-2-yl]phosphonic acid |
|---|---|
| PubChem CID | 20718903 |
| Molecular Formula | C12H18NO5PS |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | [1-[(4-methylphenyl)methylsulfonyl]pyrrolidin-2-yl]phosphonic acid |
| SMILES | Cc1ccc(CS(=O)(=O)N2CCCC2P(=O)(O)O)cc1 |
| InChI | InChI=1S/C12H18NO5PS/c1-10-4-6-11(7-5-10)9-20(17,18)13-8-2-3-12(13)19(14,15)16/h4-7,12H,2-3,8-9H2,1H3,(H2,14,15,16) |
| InChIKey | CYWSXNOTEIOYJT-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|