C19H26N2O5S — CID 124888601
2-[2-[2-[(2R)-2-ethylpiperidin-1-yl]sulfonylethoxy]ethyl]isoindole-1,3-dione (PubChem CID 124888601) has the molecular formula C19H26N2O5S and a molecular weight of 394.49 g/mol. Its IUPAC name is 2-[2-[2-[(2R)-2-ethylpiperidin-1-yl]sulfonylethoxy]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[2-[(2R)-2-ethylpiperidin-1-yl]sulfonylethoxy]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 124888601 |
| Molecular Formula | C19H26N2O5S |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | 2-[2-[2-[(2R)-2-ethylpiperidin-1-yl]sulfonylethoxy]ethyl]isoindole-1,3-dione |
| SMILES | CC[C@@H]1CCCCN1S(=O)(=O)CCOCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H26N2O5S/c1-2-15-7-5-6-10-21(15)27(24,25)14-13-26-12-11-20-18(22)16-8-3-4-9-17(16)19(20)23/h3-4,8-9,15H,2,5-7,10-14H2,1H3/t15-/m1/s1 |
| InChIKey | RYTUEQXFFVUFAS-OAHLLOKOSA-N |
| XLogP | 1.89 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|