C12H25NO3S — CID 124617691
(2R,3S)-1-(4-methoxybutylsulfonyl)-2,3-dimethylpiperidine (PubChem CID 124617691) has the molecular formula C12H25NO3S and a molecular weight of 263.40 g/mol. Its IUPAC name is (2R,3S)-1-(4-methoxybutylsulfonyl)-2,3-dimethylpiperidine.
| Compound Name | (2R,3S)-1-(4-methoxybutylsulfonyl)-2,3-dimethylpiperidine |
|---|---|
| PubChem CID | 124617691 |
| Molecular Formula | C12H25NO3S |
| Molecular Weight | 263.40 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | (2R,3S)-1-(4-methoxybutylsulfonyl)-2,3-dimethylpiperidine |
| SMILES | COCCCCS(=O)(=O)N1CCC[C@H](C)[C@H]1C |
| InChI | InChI=1S/C12H25NO3S/c1-11-7-6-8-13(12(11)2)17(14,15)10-5-4-9-16-3/h11-12H,4-10H2,1-3H3/t11-,12+/m0/s1 |
| InChIKey | DNJBJTJLFYLMSN-NWDGAFQWSA-N |
| XLogP | 1.86 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.40 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|