About 1-(chloromethylsulfonyl)-2,3-dimethylpiperidine
1-(chloromethylsulfonyl)-2,3-dimethylpiperidine (PubChem CID 63666234) has the molecular formula C8H16ClNO2S
and a molecular weight of 225.74 g/mol. Its IUPAC name is 1-(chloromethylsulfonyl)-2,3-dimethylpiperidine.
Molecular Properties
| Compound Name | 1-(chloromethylsulfonyl)-2,3-dimethylpiperidine |
| PubChem CID | 63666234 |
| Molecular Formula | C8H16ClNO2S |
| Molecular Weight | 225.74 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | 1-(chloromethylsulfonyl)-2,3-dimethylpiperidine |
| SMILES | CC1CCCN(S(=O)(=O)CCl)C1C |
| InChI | InChI=1S/C8H16ClNO2S/c1-7-4-3-5-10(8(7)2)13(11,12)6-9/h7-8H,3-6H2,1-2H3 |
| InChIKey | JUKQRZGDUWLWLT-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.74 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(chloromethylsulfonyl)-2,3-dimethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(chloromethylsulfonyl)-2,3-dimethylpiperidine?
The IUPAC name of 1-(chloromethylsulfonyl)-2,3-dimethylpiperidine (CID 63666234) is 1-(chloromethylsulfonyl)-2,3-dimethylpiperidine.
What is the SMILES notation for 1-(chloromethylsulfonyl)-2,3-dimethylpiperidine?
The canonical SMILES for 1-(chloromethylsulfonyl)-2,3-dimethylpiperidine is CC1CCCN(S(=O)(=O)CCl)C1C.
What is the InChIKey of 1-(chloromethylsulfonyl)-2,3-dimethylpiperidine?
The InChIKey is JUKQRZGDUWLWLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16ClNO2S/c1-7-4-3-5-10(8(7)2)13(11,12)6-9/h7-8H,3-6H2,1-2H3.
What are the key properties of 1-(chloromethylsulfonyl)-2,3-dimethylpiperidine?
1-(chloromethylsulfonyl)-2,3-dimethylpiperidine has a molecular weight of 225.74 g/mol, XLogP of 1.63, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(chloromethylsulfonyl)-2,3-dimethylpiperidine is sourced from PubChem (CID 63666234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).