C8H15NO6S2 — CID 102776357
3-methyl-1-(methylsulfonylmethylsulfonyl)pyrrolidine-2-carboxylic acid (PubChem CID 102776357) has the molecular formula C8H15NO6S2 and a molecular weight of 285.34 g/mol. Its IUPAC name is 3-methyl-1-(methylsulfonylmethylsulfonyl)pyrrolidine-2-carboxylic acid.
| Compound Name | 3-methyl-1-(methylsulfonylmethylsulfonyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 102776357 |
| Molecular Formula | C8H15NO6S2 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.03 |
| IUPAC Name | 3-methyl-1-(methylsulfonylmethylsulfonyl)pyrrolidine-2-carboxylic acid |
| SMILES | CC1CCN(S(=O)(=O)CS(C)(=O)=O)C1C(=O)O |
| InChI | InChI=1S/C8H15NO6S2/c1-6-3-4-9(7(6)8(10)11)17(14,15)5-16(2,12)13/h6-7H,3-5H2,1-2H3,(H,10,11) |
| InChIKey | LIJGOWWIIADANH-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 108.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |