C14H20N2O4S2 — CID 124835240
[(4aR,8aR)-4-methylsulfonyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-6-yl]-(2-methylthiophen-3-yl)methanone (PubChem CID 124835240) has the molecular formula C14H20N2O4S2 and a molecular weight of 344.46 g/mol. Its IUPAC name is [(4aR,8aR)-4-methylsulfonyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-6-yl]-(2-methylthiophen-3-yl)methanone.
| Compound Name | [(4aR,8aR)-4-methylsulfonyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-6-yl]-(2-methylthiophen-3-yl)methanone |
|---|---|
| PubChem CID | 124835240 |
| Molecular Formula | C14H20N2O4S2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | [(4aR,8aR)-4-methylsulfonyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-6-yl]-(2-methylthiophen-3-yl)methanone |
| SMILES | Cc1sccc1C(=O)N1CC[C@H]2OCCN(S(C)(=O)=O)[C@@H]2C1 |
| InChI | InChI=1S/C14H20N2O4S2/c1-10-11(4-8-21-10)14(17)15-5-3-13-12(9-15)16(6-7-20-13)22(2,18)19/h4,8,12-13H,3,5-7,9H2,1-2H3/t12-,13-/m1/s1 |
| InChIKey | NRQREYNSXDTOLA-CHWSQXEVSA-N |
| XLogP | 0.93 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |