C18H24N4O4 — CID 155870241
1-[(4aS,8aS)-4-(pyrazine-2-carbonyl)-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-6-yl]-2-(1-hydroxycyclobutyl)ethanone (PubChem CID 155870241) has the molecular formula C18H24N4O4 and a molecular weight of 360.41 g/mol. Its IUPAC name is 1-[(4aS,8aS)-4-(pyrazine-2-carbonyl)-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-6-yl]-2-(1-hydroxycyclobutyl)ethanone.
| Compound Name | 1-[(4aS,8aS)-4-(pyrazine-2-carbonyl)-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-6-yl]-2-(1-hydroxycyclobutyl)ethanone |
|---|---|
| PubChem CID | 155870241 |
| Molecular Formula | C18H24N4O4 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 1-[(4aS,8aS)-4-(pyrazine-2-carbonyl)-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-6-yl]-2-(1-hydroxycyclobutyl)ethanone |
| SMILES | O=C(CC1(O)CCC1)N1CC[C@@H]2OCCN(C(=O)c3cnccn3)[C@H]2C1 |
| InChI | InChI=1S/C18H24N4O4/c23-16(10-18(25)3-1-4-18)21-7-2-15-14(12-21)22(8-9-26-15)17(24)13-11-19-5-6-20-13/h5-6,11,14-15,25H,1-4,7-10,12H2/t14-,15-/m0/s1 |
| InChIKey | HQHKSVLQYFLEJJ-GJZGRUSLSA-N |
| XLogP | 0.22 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |