C13H16ClN3O2 — CID 103803711
2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl-(5-chloropyrazin-2-yl)methanone (PubChem CID 103803711) has the molecular formula C13H16ClN3O2 and a molecular weight of 281.74 g/mol. Its IUPAC name is 2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl-(5-chloropyrazin-2-yl)methanone.
| Compound Name | 2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl-(5-chloropyrazin-2-yl)methanone |
|---|---|
| PubChem CID | 103803711 |
| Molecular Formula | C13H16ClN3O2 |
| Molecular Weight | 281.74 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl-(5-chloropyrazin-2-yl)methanone |
| SMILES | O=C(c1cnc(Cl)cn1)N1CCOC2CCCCC21 |
| InChI | InChI=1S/C13H16ClN3O2/c14-12-8-15-9(7-16-12)13(18)17-5-6-19-11-4-2-1-3-10(11)17/h7-8,10-11H,1-6H2 |
| InChIKey | ITCPKUCJRLYMRA-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.74 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |