C10H12ClN3O3 — CID 107372202
(5-chloropyrazin-2-yl)-[3-(hydroxymethyl)morpholin-4-yl]methanone (PubChem CID 107372202) has the molecular formula C10H12ClN3O3 and a molecular weight of 257.68 g/mol. Its IUPAC name is (5-chloropyrazin-2-yl)-[3-(hydroxymethyl)morpholin-4-yl]methanone.
| Compound Name | (5-chloropyrazin-2-yl)-[3-(hydroxymethyl)morpholin-4-yl]methanone |
|---|---|
| PubChem CID | 107372202 |
| Molecular Formula | C10H12ClN3O3 |
| Molecular Weight | 257.68 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | (5-chloropyrazin-2-yl)-[3-(hydroxymethyl)morpholin-4-yl]methanone |
| SMILES | O=C(c1cnc(Cl)cn1)N1CCOCC1CO |
| InChI | InChI=1S/C10H12ClN3O3/c11-9-4-12-8(3-13-9)10(16)14-1-2-17-6-7(14)5-15/h3-4,7,15H,1-2,5-6H2 |
| InChIKey | QXFQZVVSVHFMLW-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.68 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |