C15H19N3O3 — CID 98811911
[(1R,6R,9R)-9-prop-2-enoxy-2-oxa-5-azabicyclo[4.2.1]nonan-5-yl]-pyrazin-2-ylmethanone (PubChem CID 98811911) has the molecular formula C15H19N3O3 and a molecular weight of 289.33 g/mol. Its IUPAC name is [(1R,6R,9R)-9-prop-2-enoxy-2-oxa-5-azabicyclo[4.2.1]nonan-5-yl]-pyrazin-2-ylmethanone.
| Compound Name | [(1R,6R,9R)-9-prop-2-enoxy-2-oxa-5-azabicyclo[4.2.1]nonan-5-yl]-pyrazin-2-ylmethanone |
|---|---|
| PubChem CID | 98811911 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | [(1R,6R,9R)-9-prop-2-enoxy-2-oxa-5-azabicyclo[4.2.1]nonan-5-yl]-pyrazin-2-ylmethanone |
| SMILES | C=CCO[C@@H]1[C@H]2CC[C@H]1OCCN2C(=O)c1cnccn1 |
| InChI | InChI=1S/C15H19N3O3/c1-2-8-21-14-12-3-4-13(14)20-9-7-18(12)15(19)11-10-16-5-6-17-11/h2,5-6,10,12-14H,1,3-4,7-9H2/t12-,13-,14-/m1/s1 |
| InChIKey | VYVTYQCUEPUYGO-MGPQQGTHSA-N |
| XLogP | 1.05 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|