C16H20N2O3 — CID 98811903
[(1R,6R,9R)-9-prop-2-enoxy-2-oxa-5-azabicyclo[4.2.1]nonan-5-yl]-pyridin-3-ylmethanone (PubChem CID 98811903) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is [(1R,6R,9R)-9-prop-2-enoxy-2-oxa-5-azabicyclo[4.2.1]nonan-5-yl]-pyridin-3-ylmethanone.
| Compound Name | [(1R,6R,9R)-9-prop-2-enoxy-2-oxa-5-azabicyclo[4.2.1]nonan-5-yl]-pyridin-3-ylmethanone |
|---|---|
| PubChem CID | 98811903 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | [(1R,6R,9R)-9-prop-2-enoxy-2-oxa-5-azabicyclo[4.2.1]nonan-5-yl]-pyridin-3-ylmethanone |
| SMILES | C=CCO[C@@H]1[C@H]2CC[C@H]1OCCN2C(=O)c1cccnc1 |
| InChI | InChI=1S/C16H20N2O3/c1-2-9-21-15-13-5-6-14(15)20-10-8-18(13)16(19)12-4-3-7-17-11-12/h2-4,7,11,13-15H,1,5-6,8-10H2/t13-,14-,15-/m1/s1 |
| InChIKey | UKZRNESLTSVCLZ-RBSFLKMASA-N |
| XLogP | 1.66 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|