C16H21NO3 — CID 133137687
[(2R,3aR,7aR)-2-methyl-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridin-5-yl]-(3-methoxyphenyl)methanone (PubChem CID 133137687) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is [(2R,3aR,7aR)-2-methyl-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridin-5-yl]-(3-methoxyphenyl)methanone.
| Compound Name | [(2R,3aR,7aR)-2-methyl-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridin-5-yl]-(3-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 133137687 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | [(2R,3aR,7aR)-2-methyl-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridin-5-yl]-(3-methoxyphenyl)methanone |
| SMILES | COc1cccc(C(=O)N2CC[C@H]3O[C@H](C)C[C@@H]3C2)c1 |
| InChI | InChI=1S/C16H21NO3/c1-11-8-13-10-17(7-6-15(13)20-11)16(18)12-4-3-5-14(9-12)19-2/h3-5,9,11,13,15H,6-8,10H2,1-2H3/t11-,13-,15-/m1/s1 |
| InChIKey | CGFOOHSOROOXBU-UXIGCNINSA-N |
| XLogP | 2.33 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |