C18H22N2O2 — CID 131690274
[(2S,3aS,7aS)-2-methyl-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridin-5-yl]-(1-methylindol-5-yl)methanone (PubChem CID 131690274) has the molecular formula C18H22N2O2 and a molecular weight of 298.39 g/mol. Its IUPAC name is [(2S,3aS,7aS)-2-methyl-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridin-5-yl]-(1-methylindol-5-yl)methanone.
| Compound Name | [(2S,3aS,7aS)-2-methyl-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridin-5-yl]-(1-methylindol-5-yl)methanone |
|---|---|
| PubChem CID | 131690274 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | [(2S,3aS,7aS)-2-methyl-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridin-5-yl]-(1-methylindol-5-yl)methanone |
| SMILES | C[C@H]1C[C@H]2CN(C(=O)c3ccc4c(ccn4C)c3)CC[C@@H]2O1 |
| InChI | InChI=1S/C18H22N2O2/c1-12-9-15-11-20(8-6-17(15)22-12)18(21)14-3-4-16-13(10-14)5-7-19(16)2/h3-5,7,10,12,15,17H,6,8-9,11H2,1-2H3/t12-,15-,17-/m0/s1 |
| InChIKey | XXKRKUSFSSKQNL-NUTKFTJISA-N |
| XLogP | 2.82 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |