C17H19NO2S — CID 97369382
[(2S,3aS,7aS)-2-methyl-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridin-5-yl]-(1-benzothiophen-2-yl)methanone (PubChem CID 97369382) has the molecular formula C17H19NO2S and a molecular weight of 301.41 g/mol. Its IUPAC name is [(2S,3aS,7aS)-2-methyl-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridin-5-yl]-(1-benzothiophen-2-yl)methanone.
| Compound Name | [(2S,3aS,7aS)-2-methyl-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridin-5-yl]-(1-benzothiophen-2-yl)methanone |
|---|---|
| PubChem CID | 97369382 |
| Molecular Formula | C17H19NO2S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | [(2S,3aS,7aS)-2-methyl-3,3a,4,6,7,7a-hexahydro-2H-furo[3,2-c]pyridin-5-yl]-(1-benzothiophen-2-yl)methanone |
| SMILES | C[C@H]1C[C@H]2CN(C(=O)c3cc4ccccc4s3)CC[C@@H]2O1 |
| InChI | InChI=1S/C17H19NO2S/c1-11-8-13-10-18(7-6-14(13)20-11)17(19)16-9-12-4-2-3-5-15(12)21-16/h2-5,9,11,13-14H,6-8,10H2,1H3/t11-,13-,14-/m0/s1 |
| InChIKey | NLGYLWXWSBMUOG-UBHSHLNASA-N |
| XLogP | 3.54 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |