C21H28ClN3O3 — CID 155901432
[(3aR,8aR)-1-methyl-3a-(morpholine-4-carbonyl)-3,4,5,7,8,8a-hexahydro-2H-pyrrolo[2,3-d]azepin-6-yl]-(3-chlorophenyl)methanone (PubChem CID 155901432) has the molecular formula C21H28ClN3O3 and a molecular weight of 405.93 g/mol. Its IUPAC name is [(3aR,8aR)-1-methyl-3a-(morpholine-4-carbonyl)-3,4,5,7,8,8a-hexahydro-2H-pyrrolo[2,3-d]azepin-6-yl]-(3-chlorophenyl)methanone.
| Compound Name | [(3aR,8aR)-1-methyl-3a-(morpholine-4-carbonyl)-3,4,5,7,8,8a-hexahydro-2H-pyrrolo[2,3-d]azepin-6-yl]-(3-chlorophenyl)methanone |
|---|---|
| PubChem CID | 155901432 |
| Molecular Formula | C21H28ClN3O3 |
| Molecular Weight | 405.93 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | [(3aR,8aR)-1-methyl-3a-(morpholine-4-carbonyl)-3,4,5,7,8,8a-hexahydro-2H-pyrrolo[2,3-d]azepin-6-yl]-(3-chlorophenyl)methanone |
| SMILES | CN1CC[C@@]2(C(=O)N3CCOCC3)CCN(C(=O)c3cccc(Cl)c3)CC[C@@H]12 |
| InChI | InChI=1S/C21H28ClN3O3/c1-23-9-6-21(20(27)25-11-13-28-14-12-25)7-10-24(8-5-18(21)23)19(26)16-3-2-4-17(22)15-16/h2-4,15,18H,5-14H2,1H3/t18-,21-/m1/s1 |
| InChIKey | PTNYCYQACZKLBW-WIYYLYMNSA-N |
| XLogP | 2.13 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.93 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |